C13H13NO5 — CID 57230633
(2,5-dihydroxypyrrol-1-yl) 3-methoxy-4-methylbenzoate (PubChem CID 57230633) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-methoxy-4-methylbenzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-methoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 57230633 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-methoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)On2c(O)ccc2O)ccc1C |
| InChI | InChI=1S/C13H13NO5/c1-8-3-4-9(7-10(8)18-2)13(17)19-14-11(15)5-6-12(14)16/h3-7,15-16H,1-2H3 |
| InChIKey | YAHGZZAKYFJGPJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |