C18H17NO8 — CID 9243955
1,3-benzodioxol-5-yl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate (PubChem CID 9243955) has the molecular formula C18H17NO8 and a molecular weight of 375.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 9243955 |
| Molecular Formula | C18H17NO8 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3c(c2)OCO3)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C18H17NO8/c1-22-14-5-10(6-15(23-2)17(14)24-8-16(19)20)18(21)27-11-3-4-12-13(7-11)26-9-25-12/h3-7H,8-9H2,1-2H3,(H2,19,20) |
| InChIKey | NPLFWQNYBNSQOY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|