C25H22N2O8 — CID 3099709
[3-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3099709) has the molecular formula C25H22N2O8 and a molecular weight of 478.46 g/mol. Its IUPAC name is [3-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3099709 |
| Molecular Formula | C25H22N2O8 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [3-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cccc(C=NNC(=O)c3ccc4c(c3)OCO4)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O8/c1-30-21-11-17(12-22(31-2)23(21)32-3)25(29)35-18-6-4-5-15(9-18)13-26-27-24(28)16-7-8-19-20(10-16)34-14-33-19/h4-13H,14H2,1-3H3,(H,27,28) |
| InChIKey | WECYZNXORZPUIW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|