C22H15ClN2O5 — CID 1087241
[3-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 1087241) has the molecular formula C22H15ClN2O5 and a molecular weight of 422.82 g/mol. Its IUPAC name is [3-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 1087241 |
| Molecular Formula | C22H15ClN2O5 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [3-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(NN=Cc1cccc(OC(=O)c2ccc3c(c2)OCO3)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN2O5/c23-17-5-2-4-15(10-17)21(26)25-24-12-14-3-1-6-18(9-14)30-22(27)16-7-8-19-20(11-16)29-13-28-19/h1-12H,13H2,(H,25,26) |
| InChIKey | BYNXMWWPXDEJHU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|