C23H16N2O7 — CID 1048703
[4-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 1048703) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is [4-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 1048703 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [4-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2ccc3c(c2)OCO3)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H16N2O7/c26-22(15-3-7-18-20(9-15)30-12-28-18)25-24-11-14-1-5-17(6-2-14)32-23(27)16-4-8-19-21(10-16)31-13-29-19/h1-11H,12-13H2,(H,25,26) |
| InChIKey | QAOGGBCFYSSSTH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|