C22H15BrN2O5 — CID 6279141
[4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 2-bromobenzoate (PubChem CID 6279141) has the molecular formula C22H15BrN2O5 and a molecular weight of 467.28 g/mol. Its IUPAC name is [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 2-bromobenzoate.
| Compound Name | [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 6279141 |
| Molecular Formula | C22H15BrN2O5 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]phenyl] 2-bromobenzoate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2ccccc2Br)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H15BrN2O5/c23-18-4-2-1-3-17(18)22(27)30-16-8-5-14(6-9-16)12-24-25-21(26)15-7-10-19-20(11-15)29-13-28-19/h1-12H,13H2,(H,25,26)/b24-12- |
| InChIKey | XDWJBUDHLNLBOY-MSXFZWOLSA-N |
| XLogP | 4.16 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|