C23H16Cl2N2O6 — CID 6002211
[4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate (PubChem CID 6002211) has the molecular formula C23H16Cl2N2O6 and a molecular weight of 487.30 g/mol. Its IUPAC name is [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 6002211 |
| Molecular Formula | C23H16Cl2N2O6 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [4-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc3c(c2)OCO3)ccc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H16Cl2N2O6/c1-30-20-8-13(2-6-19(20)33-23(29)15-3-5-16(24)17(25)9-15)11-26-27-22(28)14-4-7-18-21(10-14)32-12-31-18/h2-11H,12H2,1H3,(H,27,28)/b26-11- |
| InChIKey | WNANLBWHKAVCIK-RAWMCFOBSA-N |
| XLogP | 4.71 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|