C16H13ClN2O5 — CID 905733
N-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 905733) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is N-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 905733 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)OCO3)cc(Cl)c1O |
| InChI | InChI=1S/C16H13ClN2O5/c1-22-14-5-9(4-11(17)15(14)20)7-18-19-16(21)10-2-3-12-13(6-10)24-8-23-12/h2-7,20H,8H2,1H3,(H,19,21) |
| InChIKey | OLQAOTRMPRESST-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|