C22H18N2O7 — CID 5151855
[4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 5151855) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is [4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5151855 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)OCCO3)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H18N2O7/c1-27-19-11-14(4-6-17(19)31-22(26)18-3-2-8-28-18)13-23-24-21(25)15-5-7-16-20(12-15)30-10-9-29-16/h2-8,11-13H,9-10H2,1H3,(H,24,25) |
| InChIKey | RTFJUWKEUJNGNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|