C19H14BrN3O5 — CID 5458091
[4-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 5458091) has the molecular formula C19H14BrN3O5 and a molecular weight of 444.24 g/mol. Its IUPAC name is [4-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5458091 |
| Molecular Formula | C19H14BrN3O5 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | [4-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N\NC(=O)c2cncc(Br)c2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C19H14BrN3O5/c1-26-17-7-12(4-5-15(17)28-19(25)16-3-2-6-27-16)9-22-23-18(24)13-8-14(20)11-21-10-13/h2-11H,1H3,(H,23,24)/b22-9- |
| InChIKey | FCTHXSVYRYXBKU-AFPJDJCSSA-N |
| XLogP | 3.43 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|