C13H11NO5 — CID 23822868
[4-(hydroxyiminomethyl)-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 23822868) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is [4-(hydroxyiminomethyl)-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-(hydroxyiminomethyl)-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 23822868 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [4-(hydroxyiminomethyl)-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NO)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C13H11NO5/c1-17-12-7-9(8-14-16)4-5-10(12)19-13(15)11-3-2-6-18-11/h2-8,16H,1H3 |
| InChIKey | HEJOFMKGIPYDCB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|