C23H22N2O5 — CID 23789735
[2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 23789735) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 23789735 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N/c2ccc(N3CCOCC3)cc2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C23H22N2O5/c1-27-22-15-17(4-9-20(22)30-23(26)21-3-2-12-29-21)16-24-18-5-7-19(8-6-18)25-10-13-28-14-11-25/h2-9,12,15-16H,10-11,13-14H2,1H3/b24-16+ |
| InChIKey | CTTMCNZPGFCRKK-LFVJCYFKSA-N |
| XLogP | 4.09 |
| TPSA | 73.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|