C16H12N2O5S2 — CID 23934391
[2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 23934391) has the molecular formula C16H12N2O5S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is [2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 23934391 |
| Molecular Formula | C16H12N2O5S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [2-methoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NN2C(=O)CSC2=S)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C16H12N2O5S2/c1-21-13-7-10(8-17-18-14(19)9-25-16(18)24)4-5-11(13)23-15(20)12-3-2-6-22-12/h2-8H,9H2,1H3 |
| InChIKey | YRPTUHJMTNYDNQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|