C18H16N2O6S2 — CID 17026335
methyl 5-[[2-methoxy-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 17026335) has the molecular formula C18H16N2O6S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 5-[[2-methoxy-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-methoxy-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 17026335 |
| Molecular Formula | C18H16N2O6S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | methyl 5-[[2-methoxy-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=N/N3C(=O)CSC3=S)cc2OC)o1 |
| InChI | InChI=1S/C18H16N2O6S2/c1-23-15-7-11(8-19-20-16(21)10-28-18(20)27)3-5-13(15)25-9-12-4-6-14(26-12)17(22)24-2/h3-8H,9-10H2,1-2H3/b19-8+ |
| InChIKey | VXZMAALYYWWIFR-UFWORHAWSA-N |
| XLogP | 2.85 |
| TPSA | 90.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|