C18H18N4O5 — CID 9014367
methyl 5-[[2-ethoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 9014367) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is methyl 5-[[2-ethoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-ethoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 9014367 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | methyl 5-[[2-ethoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=N\n2cnnc2)ccc1OCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C18H18N4O5/c1-3-25-17-8-13(9-21-22-11-19-20-12-22)4-6-15(17)26-10-14-5-7-16(27-14)18(23)24-2/h4-9,11-12H,3,10H2,1-2H3/b21-9- |
| InChIKey | GVCNQMREWLKVNJ-NKVSQWTQSA-N |
| XLogP | 2.52 |
| TPSA | 100.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|