C17H16N4O5 — CID 3903911
5-[[2-ethoxy-4-(1,2,4-triazol-4-yliminomethyl)phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 3903911) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is 5-[[2-ethoxy-4-(1,2,4-triazol-4-yliminomethyl)phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-ethoxy-4-(1,2,4-triazol-4-yliminomethyl)phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3903911 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-[[2-ethoxy-4-(1,2,4-triazol-4-yliminomethyl)phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | CCOc1cc(C=Nn2cnnc2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C17H16N4O5/c1-2-24-16-7-12(8-20-21-10-18-19-11-21)3-5-14(16)25-9-13-4-6-15(26-13)17(22)23/h3-8,10-11H,2,9H2,1H3,(H,22,23) |
| InChIKey | VVYZLDXIJWPSTM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|