C21H28N3O5+ — CID 9058526
methyl 5-[[2-ethoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 9058526) has the molecular formula C21H28N3O5+ and a molecular weight of 402.47 g/mol. Its IUPAC name is methyl 5-[[2-ethoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-ethoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 9058526 |
| Molecular Formula | C21H28N3O5+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | methyl 5-[[2-ethoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=N\N2CC[NH+](C)CC2)ccc1OCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C21H27N3O5/c1-4-27-20-13-16(14-22-24-11-9-23(2)10-12-24)5-7-18(20)28-15-17-6-8-19(29-17)21(25)26-3/h5-8,13-14H,4,9-12,15H2,1-3H3/p+1/b22-14- |
| InChIKey | PDXFBZCKTDBIJY-HMAPJEAMSA-O |
| XLogP | 1.21 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|