C25H24N4O6 — CID 40834705
methyl 5-[[2-ethoxy-4-[(Z)-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 40834705) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is methyl 5-[[2-ethoxy-4-[(Z)-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-ethoxy-4-[(Z)-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 40834705 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | methyl 5-[[2-ethoxy-4-[(Z)-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2c(C)nc3ccccn23)ccc1OCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C25H24N4O6/c1-4-33-21-13-17(8-10-19(21)34-15-18-9-11-20(35-18)25(31)32-3)14-26-28-24(30)23-16(2)27-22-7-5-6-12-29(22)23/h5-14H,4,15H2,1-3H3,(H,28,30)/b26-14- |
| InChIKey | GVPISKCNWSNEIM-WGARJPEWSA-N |
| XLogP | 3.76 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|