C34H32BrN3O5 — CID 126409496
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126409496) has the molecular formula C34H32BrN3O5 and a molecular weight of 642.55 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126409496 |
| Molecular Formula | C34H32BrN3O5 |
| Molecular Weight | 642.55 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C34H32BrN3O5/c1-4-40-33-19-26(9-17-31(33)42-21-25-7-10-27(35)11-8-25)20-36-37-34(39)32-18-16-30(43-32)22-41-29-14-12-28(13-15-29)38-23(2)5-6-24(38)3/h5-20H,4,21-22H2,1-3H3,(H,37,39)/b36-20+ |
| InChIKey | RWUYSLQYWZOIRM-ZSNJKBEMSA-N |
| XLogP | 7.77 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.55 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|