C32H26Cl3N3O4 — CID 126410532
N-[(E)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410532) has the molecular formula C32H26Cl3N3O4 and a molecular weight of 622.94 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410532 |
| Molecular Formula | C32H26Cl3N3O4 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(OCc4ccc(Cl)c(Cl)c4)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C32H26Cl3N3O4/c1-20-3-4-21(2)38(20)24-7-9-25(10-8-24)40-19-26-11-14-31(42-26)32(39)37-36-17-22-6-13-30(29(35)15-22)41-18-23-5-12-27(33)28(34)16-23/h3-17H,18-19H2,1-2H3,(H,37,39)/b36-17+ |
| InChIKey | WATBHLPXTUOXGW-KULFSUQXSA-N |
| XLogP | 8.57 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|