C31H31ClN4O6 — CID 126405653
N-[(E)-[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405653) has the molecular formula C31H31ClN4O6 and a molecular weight of 591.06 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405653 |
| Molecular Formula | C31H31ClN4O6 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | N-[(E)-[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(OCC(=O)N4CCOCC4)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C31H31ClN4O6/c1-21-3-4-22(2)36(21)24-6-8-25(9-7-24)40-19-26-10-12-29(42-26)31(38)34-33-18-23-5-11-28(27(32)17-23)41-20-30(37)35-13-15-39-16-14-35/h3-12,17-18H,13-16,19-20H2,1-2H3,(H,34,38)/b33-18+ |
| InChIKey | GKUMBGLYRCKBAQ-DPNNOFEESA-N |
| XLogP | 4.92 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|