C33H34BrClN4O7 — CID 126410136
N-[(E)-[2-bromo-3-chloro-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410136) has the molecular formula C33H34BrClN4O7 and a molecular weight of 714.01 g/mol. Its IUPAC name is N-[(E)-[2-bromo-3-chloro-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-bromo-3-chloro-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410136 |
| Molecular Formula | C33H34BrClN4O7 |
| Molecular Weight | 714.01 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | N-[(E)-[2-bromo-3-chloro-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c(Cl)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C33H34BrClN4O7/c1-4-43-28-17-23(30(34)31(35)32(28)45-20-29(40)38-13-15-42-16-14-38)18-36-37-33(41)27-12-11-26(46-27)19-44-25-9-7-24(8-10-25)39-21(2)5-6-22(39)3/h5-12,17-18H,4,13-16,19-20H2,1-3H3,(H,37,41)/b36-18+ |
| InChIKey | UTMKJXMACPCSCS-IZYHBKOJSA-N |
| XLogP | 6.08 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.01 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|