C29H26BrClN4O5 — CID 126411044
N-[(E)-[2-bromo-3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126411044) has the molecular formula C29H26BrClN4O5 and a molecular weight of 625.91 g/mol. Its IUPAC name is N-[(E)-[2-bromo-3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-bromo-3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411044 |
| Molecular Formula | C29H26BrClN4O5 |
| Molecular Weight | 625.91 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | N-[(E)-[2-bromo-3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c(Cl)c1OCC#N |
| InChI | InChI=1S/C29H26BrClN4O5/c1-4-37-25-15-20(26(30)27(31)28(25)38-14-13-32)16-33-34-29(36)24-12-11-23(40-24)17-39-22-9-7-21(8-10-22)35-18(2)5-6-19(35)3/h5-12,15-16H,4,14,17H2,1-3H3,(H,34,36)/b33-16+ |
| InChIKey | XJBRIISPAGUKRO-MHDJOFBISA-N |
| XLogP | 6.75 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.91 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|