C32H33Br2N3O7 — CID 126405151
ethyl (2R)-2-[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]propanoate (PubChem CID 126405151) has the molecular formula C32H33Br2N3O7 and a molecular weight of 731.44 g/mol. Its IUPAC name is ethyl (2R)-2-[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126405151 |
| Molecular Formula | C32H33Br2N3O7 |
| Molecular Weight | 731.44 g/mol |
| Exact Mass | 729.07 |
| IUPAC Name | ethyl (2R)-2-[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(OCC)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c1Br |
| InChI | InChI=1S/C32H33Br2N3O7/c1-6-40-27-16-22(28(33)29(34)30(27)43-21(5)32(39)41-7-2)17-35-36-31(38)26-15-14-25(44-26)18-42-24-12-10-23(11-13-24)37-19(3)8-9-20(37)4/h8-17,21H,6-7,18H2,1-5H3,(H,36,38)/b35-17+/t21-/m1/s1 |
| InChIKey | DTPGIOPBHWQRPF-WDTKGKAJSA-N |
| XLogP | 7.28 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.44 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|