C30H31N3O6 — CID 126410063
ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate (PubChem CID 126410063) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126410063 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1ccc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1 |
| InChI | InChI=1S/C30H31N3O6/c1-5-36-30(35)22(4)38-26-12-8-23(9-13-26)18-31-32-29(34)28-17-16-27(39-28)19-37-25-14-10-24(11-15-25)33-20(2)6-7-21(33)3/h6-18,22H,5,19H2,1-4H3,(H,32,34)/b31-18+/t22-/m0/s1 |
| InChIKey | UDPOAIWRZGAZOE-RMLITALJSA-N |
| XLogP | 5.36 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|