C29H27I2N3O6 — CID 126404793
methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]propanoate (PubChem CID 126404793) has the molecular formula C29H27I2N3O6 and a molecular weight of 767.36 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]propanoate |
|---|---|
| PubChem CID | 126404793 |
| Molecular Formula | C29H27I2N3O6 |
| Molecular Weight | 767.36 g/mol |
| Exact Mass | 767.00 |
| IUPAC Name | methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(I)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1I |
| InChI | InChI=1S/C29H27I2N3O6/c1-17-5-6-18(2)34(17)21-7-9-22(10-8-21)38-16-23-11-12-26(40-23)28(35)33-32-15-20-13-24(30)27(25(31)14-20)39-19(3)29(36)37-4/h5-15,19H,16H2,1-4H3,(H,33,35)/b32-15+/t19-/m1/s1 |
| InChIKey | CFXBOMLPCYQXEF-HYRRXTCYSA-N |
| XLogP | 6.18 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|