C29H29I2N3O4 — CID 126410450
N-[(E)-[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410450) has the molecular formula C29H29I2N3O4 and a molecular weight of 737.38 g/mol. Its IUPAC name is N-[(E)-[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410450 |
| Molecular Formula | C29H29I2N3O4 |
| Molecular Weight | 737.38 g/mol |
| Exact Mass | 737.02 |
| IUPAC Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CC[C@@H](C)Oc1c(I)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1I |
| InChI | InChI=1S/C29H29I2N3O4/c1-5-20(4)37-28-25(30)14-21(15-26(28)31)16-32-33-29(35)27-13-12-24(38-27)17-36-23-10-8-22(9-11-23)34-18(2)6-7-19(34)3/h6-16,20H,5,17H2,1-4H3,(H,33,35)/b32-16+/t20-/m1/s1 |
| InChIKey | VTEZGVCENOIHLD-ODJJFFIBSA-N |
| XLogP | 7.42 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.38 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|