C28H25I2N3O6 — CID 126407229
methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]acetate (PubChem CID 126407229) has the molecular formula C28H25I2N3O6 and a molecular weight of 753.33 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126407229 |
| Molecular Formula | C28H25I2N3O6 |
| Molecular Weight | 753.33 g/mol |
| Exact Mass | 752.98 |
| IUPAC Name | methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2,6-diiodophenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1I |
| InChI | InChI=1S/C28H25I2N3O6/c1-17-4-5-18(2)33(17)20-6-8-21(9-7-20)37-15-22-10-11-25(39-22)28(35)32-31-14-19-12-23(29)27(24(30)13-19)38-16-26(34)36-3/h4-14H,15-16H2,1-3H3,(H,32,35)/b31-14+ |
| InChIKey | KUTHTTRQIUQXPW-XAZZYMPDSA-N |
| XLogP | 5.79 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|