C25H22IN3O3 — CID 126415008
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(4-iodophenyl)methylideneamino]furan-2-carboxamide (PubChem CID 126415008) has the molecular formula C25H22IN3O3 and a molecular weight of 539.37 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(4-iodophenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(4-iodophenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126415008 |
| Molecular Formula | C25H22IN3O3 |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(4-iodophenyl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(I)cc3)o2)cc1 |
| InChI | InChI=1S/C25H22IN3O3/c1-17-3-4-18(2)29(17)21-9-11-22(12-10-21)31-16-23-13-14-24(32-23)25(30)28-27-15-19-5-7-20(26)8-6-19/h3-15H,16H2,1-2H3,(H,28,30)/b27-15+ |
| InChIKey | ZLKLXYCFEMWKCW-JFLMPSFJSA-N |
| XLogP | 5.63 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|