C29H28IN3O6 — CID 126411715
methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]propanoate (PubChem CID 126411715) has the molecular formula C29H28IN3O6 and a molecular weight of 641.46 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]propanoate |
|---|---|
| PubChem CID | 126411715 |
| Molecular Formula | C29H28IN3O6 |
| Molecular Weight | 641.46 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | methyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1ccc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1I |
| InChI | InChI=1S/C29H28IN3O6/c1-18-5-6-19(2)33(18)22-8-10-23(11-9-22)37-17-24-12-14-27(39-24)28(34)32-31-16-21-7-13-26(25(30)15-21)38-20(3)29(35)36-4/h5-16,20H,17H2,1-4H3,(H,32,34)/b31-16+/t20-/m1/s1 |
| InChIKey | ZJOKPZQNUHBMFT-FHTWKPHZSA-N |
| XLogP | 5.57 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|