C29H28IN3O7 — CID 126407562
methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126407562) has the molecular formula C29H28IN3O7 and a molecular weight of 657.46 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126407562 |
| Molecular Formula | C29H28IN3O7 |
| Molecular Weight | 657.46 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | methyl 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1OC |
| InChI | InChI=1S/C29H28IN3O7/c1-18-5-6-19(2)33(18)21-7-9-22(10-8-21)38-16-23-11-12-25(40-23)29(35)32-31-15-20-13-24(30)28(26(14-20)36-3)39-17-27(34)37-4/h5-15H,16-17H2,1-4H3,(H,32,35)/b31-15+ |
| InChIKey | LTXQCNBXURXXAC-IBBHUPRXSA-N |
| XLogP | 5.20 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|