C34H33N3O6 — CID 126408692
N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126408692) has the molecular formula C34H33N3O6 and a molecular weight of 579.65 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408692 |
| Molecular Formula | C34H33N3O6 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C34H33N3O6/c1-23-10-11-24(2)37(23)27-12-14-28(15-13-27)41-22-29-16-17-30(43-29)34(38)36-35-20-26-18-31(39-3)33(32(19-26)40-4)42-21-25-8-6-5-7-9-25/h5-20H,21-22H2,1-4H3,(H,36,38)/b35-20+ |
| InChIKey | PLTQGYKMWKXILH-JEPNHJGPSA-N |
| XLogP | 6.63 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|