C33H29N5O9 — CID 126408435
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126408435) has the molecular formula C33H29N5O9 and a molecular weight of 639.62 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408435 |
| Molecular Formula | C33H29N5O9 |
| Molecular Weight | 639.62 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc([N+](=O)[O-])c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H29N5O9/c1-21-4-5-22(2)36(21)25-10-12-27(13-11-25)45-20-28-14-15-30(47-28)33(39)35-34-18-24-16-29(38(42)43)32(31(17-24)44-3)46-19-23-6-8-26(9-7-23)37(40)41/h4-18H,19-20H2,1-3H3,(H,35,39)/b34-18+ |
| InChIKey | OVUUNPIZYGDLQQ-FABQOPTDSA-N |
| XLogP | 6.43 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|