C34H31FN4O7 — CID 126408326
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126408326) has the molecular formula C34H31FN4O7 and a molecular weight of 626.64 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408326 |
| Molecular Formula | C34H31FN4O7 |
| Molecular Weight | 626.64 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc([N+](=O)[O-])c1OCc1ccccc1F |
| InChI | InChI=1S/C34H31FN4O7/c1-4-43-32-18-24(17-30(39(41)42)33(32)45-20-25-7-5-6-8-29(25)35)19-36-37-34(40)31-16-15-28(46-31)21-44-27-13-11-26(12-14-27)38-22(2)9-10-23(38)3/h5-19H,4,20-21H2,1-3H3,(H,37,40)/b36-19+ |
| InChIKey | OIRACFLBFNWAMZ-ODNPBWNPSA-N |
| XLogP | 7.06 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|