C32H27FN4O6 — CID 126411337
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-[(2-fluorophenyl)methoxy]-3-nitrophenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126411337) has the molecular formula C32H27FN4O6 and a molecular weight of 582.59 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-[(2-fluorophenyl)methoxy]-3-nitrophenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-[(2-fluorophenyl)methoxy]-3-nitrophenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411337 |
| Molecular Formula | C32H27FN4O6 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-[(2-fluorophenyl)methoxy]-3-nitrophenyl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc([N+](=O)[O-])c3OCc3ccccc3F)o2)cc1 |
| InChI | InChI=1S/C32H27FN4O6/c1-21-10-11-22(2)36(21)25-12-14-26(15-13-25)41-20-27-16-17-30(43-27)32(38)35-34-18-23-7-5-9-29(37(39)40)31(23)42-19-24-6-3-4-8-28(24)33/h3-18H,19-20H2,1-2H3,(H,35,38)/b34-18+ |
| InChIKey | YCWIJCVQGFAZAH-FABQOPTDSA-N |
| XLogP | 6.66 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|