C34H29FN4O3 — CID 126411867
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126411867) has the molecular formula C34H29FN4O3 and a molecular weight of 560.63 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411867 |
| Molecular Formula | C34H29FN4O3 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cn(Cc4ccccc4F)c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C34H29FN4O3/c1-23-11-12-24(2)39(23)27-13-15-28(16-14-27)41-22-29-17-18-33(42-29)34(40)37-36-19-26-21-38(32-10-6-4-8-30(26)32)20-25-7-3-5-9-31(25)35/h3-19,21H,20,22H2,1-2H3,(H,37,40)/b36-19+ |
| InChIKey | ZWAYOPPRPASYAF-ODNPBWNPSA-N |
| XLogP | 7.17 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|