C39H36FN5O5 — CID 126407415
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126407415) has the molecular formula C39H36FN5O5 and a molecular weight of 673.75 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407415 |
| Molecular Formula | C39H36FN5O5 |
| Molecular Weight | 673.75 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(C)n(-c4ccc(OCC(=O)Nc5ccccc5F)cc4)c3C)o2)cc1 |
| InChI | InChI=1S/C39H36FN5O5/c1-25-9-10-26(2)44(25)30-11-15-32(16-12-30)48-23-34-19-20-37(50-34)39(47)43-41-22-29-21-27(3)45(28(29)4)31-13-17-33(18-14-31)49-24-38(46)42-36-8-6-5-7-35(36)40/h5-22H,23-24H2,1-4H3,(H,42,46)(H,43,47)/b41-22+ |
| InChIKey | LIXLBHOKCNLSRP-YNPASXIJSA-N |
| XLogP | 7.59 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|