C31H36N4O3 — CID 126412088
N-[(E)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126412088) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[(E)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126412088 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N-[(E)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(C)n(C4CCCCC4)c3C)o2)cc1 |
| InChI | InChI=1S/C31H36N4O3/c1-21-10-11-22(2)34(21)27-12-14-28(15-13-27)37-20-29-16-17-30(38-29)31(36)33-32-19-25-18-23(3)35(24(25)4)26-8-6-5-7-9-26/h10-19,26H,5-9,20H2,1-4H3,(H,33,36)/b32-19+ |
| InChIKey | GVQYGYAOHHBFHU-BIZUNTBRSA-N |
| XLogP | 6.95 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|