C34H32N4O4 — CID 126404669
N-[(E)-[2,5-dimethyl-1-(4-prop-2-ynoxyphenyl)pyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126404669) has the molecular formula C34H32N4O4 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(4-prop-2-ynoxyphenyl)pyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(4-prop-2-ynoxyphenyl)pyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126404669 |
| Molecular Formula | C34H32N4O4 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(4-prop-2-ynoxyphenyl)pyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | C#CCOc1ccc(-n2c(C)cc(/C=N/NC(=O)c3ccc(COc4ccc(-n5c(C)ccc5C)cc4)o3)c2C)cc1 |
| InChI | InChI=1S/C34H32N4O4/c1-6-19-40-30-13-11-29(12-14-30)38-25(4)20-27(26(38)5)21-35-36-34(39)33-18-17-32(42-33)22-41-31-15-9-28(10-16-31)37-23(2)7-8-24(37)3/h1,7-18,20-21H,19,22H2,2-5H3,(H,36,39)/b35-21+ |
| InChIKey | BNWWKUCAIDBXKY-XICOUIIWSA-N |
| XLogP | 6.45 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|