C32H31N5O6 — CID 126411173
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126411173) has the molecular formula C32H31N5O6 and a molecular weight of 581.63 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411173 |
| Molecular Formula | C32H31N5O6 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=N/NC(=O)c3ccc(COc4ccc(-n5c(C)ccc5C)cc4)o3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H31N5O6/c1-20-6-7-21(2)35(20)25-8-10-26(11-9-25)42-19-28-13-15-31(43-28)32(38)34-33-18-24-16-22(3)36(23(24)4)29-14-12-27(41-5)17-30(29)37(39)40/h6-18H,19H2,1-5H3,(H,34,38)/b33-18+ |
| InChIKey | CLYNVQROPCOEGI-DPNNOFEESA-N |
| XLogP | 6.35 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|