C32H31IN4O3 — CID 126410659
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126410659) has the molecular formula C32H31IN4O3 and a molecular weight of 646.53 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410659 |
| Molecular Formula | C32H31IN4O3 |
| Molecular Weight | 646.53 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1cc(-n2c(C)cc(/C=N/NC(=O)c3ccc(COc4ccc(-n5c(C)ccc5C)cc4)o3)c2C)ccc1I |
| InChI | InChI=1S/C32H31IN4O3/c1-20-16-27(10-14-30(20)33)37-23(4)17-25(24(37)5)18-34-35-32(38)31-15-13-29(40-31)19-39-28-11-8-26(9-12-28)36-21(2)6-7-22(36)3/h6-18H,19H2,1-5H3,(H,35,38)/b34-18+ |
| InChIKey | AZAXSLIBZJKFNI-FABQOPTDSA-N |
| XLogP | 7.35 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|