C30H26N4O3 — CID 3880892
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(1-prop-2-ynylindol-3-yl)methylideneamino]furan-2-carboxamide (PubChem CID 3880892) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(1-prop-2-ynylindol-3-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(1-prop-2-ynylindol-3-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 3880892 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(1-prop-2-ynylindol-3-yl)methylideneamino]furan-2-carboxamide |
| SMILES | C#CCn1cc(C=NNC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c2ccccc21 |
| InChI | InChI=1S/C30H26N4O3/c1-4-17-33-19-23(27-7-5-6-8-28(27)33)18-31-32-30(35)29-16-15-26(37-29)20-36-25-13-11-24(12-14-25)34-21(2)9-10-22(34)3/h1,5-16,18-19H,17,20H2,2-3H3,(H,32,35) |
| InChIKey | CRVMCWKDMAIHHS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|