C31H30N4O5 — CID 126404644
methyl (2S)-2-[3-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]indol-1-yl]propanoate (PubChem CID 126404644) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is methyl (2S)-2-[3-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]indol-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[3-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]indol-1-yl]propanoate |
|---|---|
| PubChem CID | 126404644 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | methyl (2S)-2-[3-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]indol-1-yl]propanoate |
| SMILES | COC(=O)[C@H](C)n1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c2ccccc21 |
| InChI | InChI=1S/C31H30N4O5/c1-20-9-10-21(2)35(20)24-11-13-25(14-12-24)39-19-26-15-16-29(40-26)30(36)33-32-17-23-18-34(22(3)31(37)38-4)28-8-6-5-7-27(23)28/h5-18,22H,19H2,1-4H3,(H,33,36)/b32-17+/t22-/m0/s1 |
| InChIKey | BIOGXWNDZCEJFC-NYHPFTRHSA-N |
| XLogP | 5.72 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|