C29H25FN4O3 — CID 124551822
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]furan-2-carboxamide (PubChem CID 124551822) has the molecular formula C29H25FN4O3 and a molecular weight of 496.54 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 124551822 |
| Molecular Formula | C29H25FN4O3 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-(2-fluorophenyl)pyrrol-2-yl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccn3-c3ccccc3F)o2)cc1 |
| InChI | InChI=1S/C29H25FN4O3/c1-20-9-10-21(2)34(20)22-11-13-24(14-12-22)36-19-25-15-16-28(37-25)29(35)32-31-18-23-6-5-17-33(23)27-8-4-3-7-26(27)30/h3-18H,19H2,1-2H3,(H,32,35)/b31-18+ |
| InChIKey | WYBATEARIJQSKA-FDAWAROLSA-N |
| XLogP | 5.96 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|