C33H29FN4O5 — CID 126408364
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126408364) has the molecular formula C33H29FN4O5 and a molecular weight of 580.62 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408364 |
| Molecular Formula | C33H29FN4O5 |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc(OCC(=O)Nc4ccccc4F)c3)o2)cc1 |
| InChI | InChI=1S/C33H29FN4O5/c1-22-10-11-23(2)38(22)25-12-14-26(15-13-25)41-20-28-16-17-31(43-28)33(40)37-35-19-24-6-5-7-27(18-24)42-21-32(39)36-30-9-4-3-8-29(30)34/h3-19H,20-21H2,1-2H3,(H,36,39)(H,37,40)/b35-19+ |
| InChIKey | OKLSHGUJZOKZNB-XZYGTATASA-N |
| XLogP | 6.19 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|