C32H26BrN5O8 — CID 126406110
N-[(E)-[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406110) has the molecular formula C32H26BrN5O8 and a molecular weight of 688.49 g/mol. Its IUPAC name is N-[(E)-[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406110 |
| Molecular Formula | C32H26BrN5O8 |
| Molecular Weight | 688.49 g/mol |
| Exact Mass | 687.10 |
| IUPAC Name | N-[(E)-[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Br)cc([N+](=O)[O-])c3OCc3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C32H26BrN5O8/c1-20-6-7-21(2)36(20)25-8-10-27(11-9-25)44-19-28-12-13-30(46-28)32(39)35-34-17-23-15-24(33)16-29(38(42)43)31(23)45-18-22-4-3-5-26(14-22)37(40)41/h3-17H,18-19H2,1-2H3,(H,35,39)/b34-17+ |
| InChIKey | HOVBLIMKTVENCT-KVAAJVFYSA-N |
| XLogP | 7.19 |
| TPSA | 164.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|