C38H35N3O6 — CID 126405266
N-[(E)-[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405266) has the molecular formula C38H35N3O6 and a molecular weight of 629.71 g/mol. Its IUPAC name is N-[(E)-[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405266 |
| Molecular Formula | C38H35N3O6 |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | N-[(E)-[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C38H35N3O6/c1-25-12-13-26(2)41(25)30-14-16-31(17-15-30)45-24-32-18-19-34(47-32)38(42)40-39-22-27-20-35(43-3)37(36(21-27)44-4)46-23-29-10-7-9-28-8-5-6-11-33(28)29/h5-22H,23-24H2,1-4H3,(H,40,42)/b39-22+ |
| InChIKey | FFVRVRPHVGTFHZ-WVKHYPTHSA-N |
| XLogP | 7.78 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|