C32H34N4O9 — CID 126407988
ethyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxy-6-nitrophenoxy]propanoate (PubChem CID 126407988) has the molecular formula C32H34N4O9 and a molecular weight of 618.64 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxy-6-nitrophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxy-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126407988 |
| Molecular Formula | C32H34N4O9 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | ethyl (2R)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxy-6-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(OCC)cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H34N4O9/c1-6-41-29-17-23(16-27(36(39)40)30(29)44-22(5)32(38)42-7-2)18-33-34-31(37)28-15-14-26(45-28)19-43-25-12-10-24(11-13-25)35-20(3)8-9-21(35)4/h8-18,22H,6-7,19H2,1-5H3,(H,34,37)/b33-18+/t22-/m1/s1 |
| InChIKey | NGZVXBFVGWOKST-HQMQAWNESA-N |
| XLogP | 5.67 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|