C27H24BrN5O7 — CID 126411750
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126411750) has the molecular formula C27H24BrN5O7 and a molecular weight of 610.42 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411750 |
| Molecular Formula | C27H24BrN5O7 |
| Molecular Weight | 610.42 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-bromo-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Br)c(OCC(N)=O)c([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C27H24BrN5O7/c1-16-3-4-17(2)32(16)19-5-7-20(8-6-19)38-14-21-9-10-24(40-21)27(35)31-30-13-18-11-22(28)26(39-15-25(29)34)23(12-18)33(36)37/h3-13H,14-15H2,1-2H3,(H2,29,34)(H,31,35)/b30-13+ |
| InChIKey | ZLSASPVWZDCQDU-VVEOGCPPSA-N |
| XLogP | 4.56 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|