C30H30N4O8 — CID 126405403
ethyl (2R)-2-[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-4-nitrophenoxy]propanoate (PubChem CID 126405403) has the molecular formula C30H30N4O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-4-nitrophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-4-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126405403 |
| Molecular Formula | C30H30N4O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | ethyl (2R)-2-[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-4-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)c1ccc(COc2ccc(-n3c(C)ccc3C)cc2)o1 |
| InChI | InChI=1S/C30H30N4O8/c1-5-39-30(36)21(4)41-27-14-10-24(34(37)38)16-22(27)17-31-32-29(35)28-15-13-26(42-28)18-40-25-11-8-23(9-12-25)33-19(2)6-7-20(33)3/h6-17,21H,5,18H2,1-4H3,(H,32,35)/b31-17+/t21-/m1/s1 |
| InChIKey | FTLBVHIRZTYSPG-MYNWXPLZSA-N |
| XLogP | 5.27 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|